About 2-amino-1,3-dioxepan-2-ol
2-amino-1,3-dioxepan-2-ol (PubChem CID 57284913) has the molecular formula C5H11NO3
and a molecular weight of 133.15 g/mol. Its IUPAC name is 2-amino-1,3-dioxepan-2-ol.
Molecular Properties
| Compound Name | 2-amino-1,3-dioxepan-2-ol |
| PubChem CID | 57284913 |
| Molecular Formula | C5H11NO3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.07 |
| IUPAC Name | 2-amino-1,3-dioxepan-2-ol |
| SMILES | NC1(O)OCCCCO1 |
| InChI | InChI=1S/C5H11NO3/c6-5(7)8-3-1-2-4-9-5/h7H,1-4,6H2 |
| InChIKey | UVKJAEPOYHZOLW-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-1,3-dioxepan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1,3-dioxepan-2-ol?
The IUPAC name of 2-amino-1,3-dioxepan-2-ol (CID 57284913) is 2-amino-1,3-dioxepan-2-ol.
What is the SMILES notation for 2-amino-1,3-dioxepan-2-ol?
The canonical SMILES for 2-amino-1,3-dioxepan-2-ol is NC1(O)OCCCCO1.
What is the InChIKey of 2-amino-1,3-dioxepan-2-ol?
The InChIKey is UVKJAEPOYHZOLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO3/c6-5(7)8-3-1-2-4-9-5/h7H,1-4,6H2.
What are the key properties of 2-amino-1,3-dioxepan-2-ol?
2-amino-1,3-dioxepan-2-ol has a molecular weight of 133.15 g/mol, XLogP of -0.62, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1,3-dioxepan-2-ol is sourced from PubChem (CID 57284913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).