C21H34O2 — CID 57284963
(8S,9R,10S,13R,14S)-10-(hydroxymethyl)-6,13,17-trimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-2-ol (PubChem CID 57284963) has the molecular formula C21H34O2 and a molecular weight of 318.50 g/mol. Its IUPAC name is (8S,9R,10S,13R,14S)-10-(hydroxymethyl)-6,13,17-trimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-2-ol.
| Compound Name | (8S,9R,10S,13R,14S)-10-(hydroxymethyl)-6,13,17-trimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-2-ol |
|---|---|
| PubChem CID | 57284963 |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | (8S,9R,10S,13R,14S)-10-(hydroxymethyl)-6,13,17-trimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-2-ol |
| SMILES | CC1C[C@@H]2[C@@H](CC[C@]3(C)C(C)CC[C@@H]23)[C@@]2(CO)CC(O)CC=C12 |
| InChI | InChI=1S/C21H34O2/c1-13-10-16-18-6-4-14(2)20(18,3)9-8-19(16)21(12-22)11-15(23)5-7-17(13)21/h7,13-16,18-19,22-23H,4-6,8-12H2,1-3H3/t13?,14?,15?,16-,18-,19+,20+,21+/m0/s1 |
| InChIKey | UBFBLXMHHHEHAF-GBZVZBFKSA-N |
| XLogP | 4.16 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|