About 12aH-indolo[2,3-a]quinolizin-4-one
12aH-indolo[2,3-a]quinolizin-4-one (PubChem CID 57285685) has the molecular formula C15H10N2O
and a molecular weight of 234.26 g/mol. Its IUPAC name is 12aH-indolo[2,3-a]quinolizin-4-one.
Molecular Properties
| Compound Name | 12aH-indolo[2,3-a]quinolizin-4-one |
| PubChem CID | 57285685 |
| Molecular Formula | C15H10N2O |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 12aH-indolo[2,3-a]quinolizin-4-one |
| SMILES | O=c1cccc2n1C=CC1=c3ccccc3=NC12 |
| InChI | InChI=1S/C15H10N2O/c18-14-7-3-6-13-15-11(8-9-17(13)14)10-4-1-2-5-12(10)16-15/h1-9,15H |
| InChIKey | YAZVPTUCMMMMSR-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 12aH-indolo[2,3-a]quinolizin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12aH-indolo[2,3-a]quinolizin-4-one?
The IUPAC name of 12aH-indolo[2,3-a]quinolizin-4-one (CID 57285685) is 12aH-indolo[2,3-a]quinolizin-4-one.
What is the SMILES notation for 12aH-indolo[2,3-a]quinolizin-4-one?
The canonical SMILES for 12aH-indolo[2,3-a]quinolizin-4-one is O=c1cccc2n1C=CC1=c3ccccc3=NC12.
What is the InChIKey of 12aH-indolo[2,3-a]quinolizin-4-one?
The InChIKey is YAZVPTUCMMMMSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10N2O/c18-14-7-3-6-13-15-11(8-9-17(13)14)10-4-1-2-5-12(10)16-15/h1-9,15H.
What are the key properties of 12aH-indolo[2,3-a]quinolizin-4-one?
12aH-indolo[2,3-a]quinolizin-4-one has a molecular weight of 234.26 g/mol, XLogP of 0.86, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 12aH-indolo[2,3-a]quinolizin-4-one is sourced from PubChem (CID 57285685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).