C28H32F3N5O9S — CID 57286068
[(2R,3S,4R,5R)-2-(6-benzamidopurin-9-yl)-4-(oxan-2-yloxy)-5-(oxan-2-yloxymethyl)oxolan-3-yl] trifluoromethanesulfonate (PubChem CID 57286068) has the molecular formula C28H32F3N5O9S and a molecular weight of 671.65 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-2-(6-benzamidopurin-9-yl)-4-(oxan-2-yloxy)-5-(oxan-2-yloxymethyl)oxolan-3-yl] trifluoromethanesulfonate.
| Compound Name | [(2R,3S,4R,5R)-2-(6-benzamidopurin-9-yl)-4-(oxan-2-yloxy)-5-(oxan-2-yloxymethyl)oxolan-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 57286068 |
| Molecular Formula | C28H32F3N5O9S |
| Molecular Weight | 671.65 g/mol |
| Exact Mass | 671.19 |
| IUPAC Name | [(2R,3S,4R,5R)-2-(6-benzamidopurin-9-yl)-4-(oxan-2-yloxy)-5-(oxan-2-yloxymethyl)oxolan-3-yl] trifluoromethanesulfonate |
| SMILES | O=C(Nc1ncnc2c1ncn2[C@@H]1O[C@H](COC2CCCCO2)[C@@H](OC2CCCCO2)[C@@H]1OS(=O)(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C28H32F3N5O9S/c29-28(30,31)46(38,39)45-23-22(44-20-11-5-7-13-41-20)18(14-42-19-10-4-6-12-40-19)43-27(23)36-16-34-21-24(32-15-33-25(21)36)35-26(37)17-8-2-1-3-9-17/h1-3,8-9,15-16,18-20,22-23,27H,4-7,10-14H2,(H,32,33,35,37)/t18-,19?,20?,22-,23+,27-/m1/s1 |
| InChIKey | GIBMUVLSLMKPQO-QKHNVQEPSA-N |
| XLogP | 3.67 |
| TPSA | 162.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.65 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|