About 2-cyclopropylaziridine
2-cyclopropylaziridine (PubChem CID 57286269) has the molecular formula C5H9N
and a molecular weight of 83.13 g/mol. Its IUPAC name is 2-cyclopropylaziridine.
Molecular Properties
| Compound Name | 2-cyclopropylaziridine |
| PubChem CID | 57286269 |
| Molecular Formula | C5H9N |
| Molecular Weight | 83.13 g/mol |
| Exact Mass | 83.07 |
| IUPAC Name | 2-cyclopropylaziridine |
| SMILES | C1CC1C1CN1 |
| InChI | InChI=1S/C5H9N/c1-2-4(1)5-3-6-5/h4-6H,1-3H2 |
| InChIKey | TWSHAOXXFOESKM-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 21.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 83.13 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclopropylaziridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropylaziridine?
The IUPAC name of 2-cyclopropylaziridine (CID 57286269) is 2-cyclopropylaziridine.
What is the SMILES notation for 2-cyclopropylaziridine?
The canonical SMILES for 2-cyclopropylaziridine is C1CC1C1CN1.
What is the InChIKey of 2-cyclopropylaziridine?
The InChIKey is TWSHAOXXFOESKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N/c1-2-4(1)5-3-6-5/h4-6H,1-3H2.
What are the key properties of 2-cyclopropylaziridine?
2-cyclopropylaziridine has a molecular weight of 83.13 g/mol, XLogP of 0.37, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropylaziridine is sourced from PubChem (CID 57286269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).