About (3,3,7-trimethyl-8-tricyclo[5.4.0.02,9]undecanyl)methanol
(3,3,7-trimethyl-8-tricyclo[5.4.0.02,9]undecanyl)methanol (PubChem CID 572865) has the molecular formula C15H26O
and a molecular weight of 222.37 g/mol. Its IUPAC name is (3,3,7-trimethyl-8-tricyclo[5.4.0.02,9]undecanyl)methanol.
Analyze (3,3,7-trimethyl-8-tricyclo[5.4.0.02,9]undecanyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,3,7-trimethyl-8-tricyclo[5.4.0.02,9]undecanyl)methanol?
The IUPAC name of (3,3,7-trimethyl-8-tricyclo[5.4.0.02,9]undecanyl)methanol (CID 572865) is (3,3,7-trimethyl-8-tricyclo[5.4.0.02,9]undecanyl)methanol.
What is the SMILES notation for (3,3,7-trimethyl-8-tricyclo[5.4.0.02,9]undecanyl)methanol?
The canonical SMILES for (3,3,7-trimethyl-8-tricyclo[5.4.0.02,9]undecanyl)methanol is CC1(C)CCCC2(C)C(CO)C3CCC2C31.
What is the InChIKey of (3,3,7-trimethyl-8-tricyclo[5.4.0.02,9]undecanyl)methanol?
The InChIKey is VZJHQHUOVIDRCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O/c1-14(2)7-4-8-15(3)11-6-5-10(13(11)14)12(15)9-16/h10-13,16H,4-9H2,1-3H3.
What are the key properties of (3,3,7-trimethyl-8-tricyclo[5.4.0.02,9]undecanyl)methanol?
(3,3,7-trimethyl-8-tricyclo[5.4.0.02,9]undecanyl)methanol has a molecular weight of 222.37 g/mol, XLogP of 3.47, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3,3,7-trimethyl-8-tricyclo[5.4.0.02,9]undecanyl)methanol is sourced from PubChem (CID 572865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).