C8H10O2 — CID 57286518
(3aS,6aS)-5-methylidene-3a,4,6,6a-tetrahydro-1H-cyclopenta[c]furan-3-one (PubChem CID 57286518) has the molecular formula C8H10O2 and a molecular weight of 138.17 g/mol. Its IUPAC name is (3aS,6aS)-5-methylidene-3a,4,6,6a-tetrahydro-1H-cyclopenta[c]furan-3-one.
| Compound Name | (3aS,6aS)-5-methylidene-3a,4,6,6a-tetrahydro-1H-cyclopenta[c]furan-3-one |
|---|---|
| PubChem CID | 57286518 |
| Molecular Formula | C8H10O2 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.07 |
| IUPAC Name | (3aS,6aS)-5-methylidene-3a,4,6,6a-tetrahydro-1H-cyclopenta[c]furan-3-one |
| SMILES | C=C1C[C@@H]2COC(=O)[C@H]2C1 |
| InChI | InChI=1S/C8H10O2/c1-5-2-6-4-10-8(9)7(6)3-5/h6-7H,1-4H2/t6-,7+/m1/s1 |
| InChIKey | FHSPHORVAOQBCD-RQJHMYQMSA-N |
| XLogP | 1.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|