C7H9F5O2S — CID 57286604
1-ethylsulfonyl-4,4,5,5,5-pentafluoropent-1-ene (PubChem CID 57286604) has the molecular formula C7H9F5O2S and a molecular weight of 252.20 g/mol. Its IUPAC name is 1-ethylsulfonyl-4,4,5,5,5-pentafluoropent-1-ene.
| Compound Name | 1-ethylsulfonyl-4,4,5,5,5-pentafluoropent-1-ene |
|---|---|
| PubChem CID | 57286604 |
| Molecular Formula | C7H9F5O2S |
| Molecular Weight | 252.20 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | 1-ethylsulfonyl-4,4,5,5,5-pentafluoropent-1-ene |
| SMILES | CCS(=O)(=O)C=CCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H9F5O2S/c1-2-15(13,14)5-3-4-6(8,9)7(10,11)12/h3,5H,2,4H2,1H3 |
| InChIKey | CRHHHLHAJIEIQB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.20 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|