About 9-(5-aminohexyl)-3,7-dimethyl-8H-purine-2,6-dione
9-(5-aminohexyl)-3,7-dimethyl-8H-purine-2,6-dione (PubChem CID 57287057) has the molecular formula C13H23N5O2
and a molecular weight of 281.36 g/mol. Its IUPAC name is 9-(5-aminohexyl)-3,7-dimethyl-8H-purine-2,6-dione.
Molecular Properties
| Compound Name | 9-(5-aminohexyl)-3,7-dimethyl-8H-purine-2,6-dione |
| PubChem CID | 57287057 |
| Molecular Formula | C13H23N5O2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 9-(5-aminohexyl)-3,7-dimethyl-8H-purine-2,6-dione |
| SMILES | CC(N)CCCCN1CN(C)c2c1n(C)c(=O)[nH]c2=O |
| InChI | InChI=1S/C13H23N5O2/c1-9(14)6-4-5-7-18-8-16(2)10-11(19)15-13(20)17(3)12(10)18/h9H,4-8,14H2,1-3H3,(H,15,19,20) |
| InChIKey | ZQDUGGNQNHKAST-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9-(5-aminohexyl)-3,7-dimethyl-8H-purine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(5-aminohexyl)-3,7-dimethyl-8H-purine-2,6-dione?
The IUPAC name of 9-(5-aminohexyl)-3,7-dimethyl-8H-purine-2,6-dione (CID 57287057) is 9-(5-aminohexyl)-3,7-dimethyl-8H-purine-2,6-dione.
What is the SMILES notation for 9-(5-aminohexyl)-3,7-dimethyl-8H-purine-2,6-dione?
The canonical SMILES for 9-(5-aminohexyl)-3,7-dimethyl-8H-purine-2,6-dione is CC(N)CCCCN1CN(C)c2c1n(C)c(=O)[nH]c2=O.
What is the InChIKey of 9-(5-aminohexyl)-3,7-dimethyl-8H-purine-2,6-dione?
The InChIKey is ZQDUGGNQNHKAST-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N5O2/c1-9(14)6-4-5-7-18-8-16(2)10-11(19)15-13(20)17(3)12(10)18/h9H,4-8,14H2,1-3H3,(H,15,19,20).
What are the key properties of 9-(5-aminohexyl)-3,7-dimethyl-8H-purine-2,6-dione?
9-(5-aminohexyl)-3,7-dimethyl-8H-purine-2,6-dione has a molecular weight of 281.36 g/mol, XLogP of -0.20, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(5-aminohexyl)-3,7-dimethyl-8H-purine-2,6-dione is sourced from PubChem (CID 57287057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).