About 2-[(7S)-7-(5-hydroxy-4,8-dimethylnon-7-enyl)-7-methyl-6-oxooxepan-3-ylidene]acetic acid
2-[(7S)-7-(5-hydroxy-4,8-dimethylnon-7-enyl)-7-methyl-6-oxooxepan-3-ylidene]acetic acid (PubChem CID 57287699) has the molecular formula C20H32O5
and a molecular weight of 352.47 g/mol. Its IUPAC name is 2-[(7S)-7-(5-hydroxy-4,8-dimethylnon-7-enyl)-7-methyl-6-oxooxepan-3-ylidene]acetic acid.
Molecular Properties
| Compound Name | 2-[(7S)-7-(5-hydroxy-4,8-dimethylnon-7-enyl)-7-methyl-6-oxooxepan-3-ylidene]acetic acid |
| PubChem CID | 57287699 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 2-[(7S)-7-(5-hydroxy-4,8-dimethylnon-7-enyl)-7-methyl-6-oxooxepan-3-ylidene]acetic acid |
| SMILES | CC(C)=CCC(O)C(C)CCC[C@]1(C)OCC(=CC(=O)O)CCC1=O |
| InChI | InChI=1S/C20H32O5/c1-14(2)7-9-17(21)15(3)6-5-11-20(4)18(22)10-8-16(13-25-20)12-19(23)24/h7,12,15,17,21H,5-6,8-11,13H2,1-4H3,(H,23,24)/t15?,17?,20-/m0/s1 |
| InChIKey | ZQHALBYHEGAMBI-LAGYLCCXSA-N |
| XLogP | 3.66 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(7S)-7-(5-hydroxy-4,8-dimethylnon-7-enyl)-7-methyl-6-oxooxepan-3-ylidene]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(7S)-7-(5-hydroxy-4,8-dimethylnon-7-enyl)-7-methyl-6-oxooxepan-3-ylidene]acetic acid?
The IUPAC name of 2-[(7S)-7-(5-hydroxy-4,8-dimethylnon-7-enyl)-7-methyl-6-oxooxepan-3-ylidene]acetic acid (CID 57287699) is 2-[(7S)-7-(5-hydroxy-4,8-dimethylnon-7-enyl)-7-methyl-6-oxooxepan-3-ylidene]acetic acid.
What is the SMILES notation for 2-[(7S)-7-(5-hydroxy-4,8-dimethylnon-7-enyl)-7-methyl-6-oxooxepan-3-ylidene]acetic acid?
The canonical SMILES for 2-[(7S)-7-(5-hydroxy-4,8-dimethylnon-7-enyl)-7-methyl-6-oxooxepan-3-ylidene]acetic acid is CC(C)=CCC(O)C(C)CCC[C@]1(C)OCC(=CC(=O)O)CCC1=O.
What is the InChIKey of 2-[(7S)-7-(5-hydroxy-4,8-dimethylnon-7-enyl)-7-methyl-6-oxooxepan-3-ylidene]acetic acid?
The InChIKey is ZQHALBYHEGAMBI-LAGYLCCXSA-N. The full InChI is InChI=1S/C20H32O5/c1-14(2)7-9-17(21)15(3)6-5-11-20(4)18(22)10-8-16(13-25-20)12-19(23)24/h7,12,15,17,21H,5-6,8-11,13H2,1-4H3,(H,23,24)/t15?,17?,20-/m0/s1.
What are the key properties of 2-[(7S)-7-(5-hydroxy-4,8-dimethylnon-7-enyl)-7-methyl-6-oxooxepan-3-ylidene]acetic acid?
2-[(7S)-7-(5-hydroxy-4,8-dimethylnon-7-enyl)-7-methyl-6-oxooxepan-3-ylidene]acetic acid has a molecular weight of 352.47 g/mol, XLogP of 3.66, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(7S)-7-(5-hydroxy-4,8-dimethylnon-7-enyl)-7-methyl-6-oxooxepan-3-ylidene]acetic acid is sourced from PubChem (CID 57287699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).