C25H44O2Si — CID 57287768
(1R,7aR)-1-[(2R)-1-[(1S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-4-methylcyclopent-2-en-1-yl]propan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one (PubChem CID 57287768) has the molecular formula C25H44O2Si and a molecular weight of 404.71 g/mol. Its IUPAC name is (1R,7aR)-1-[(2R)-1-[(1S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-4-methylcyclopent-2-en-1-yl]propan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one.
| Compound Name | (1R,7aR)-1-[(2R)-1-[(1S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-4-methylcyclopent-2-en-1-yl]propan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
|---|---|
| PubChem CID | 57287768 |
| Molecular Formula | C25H44O2Si |
| Molecular Weight | 404.71 g/mol |
| Exact Mass | 404.31 |
| IUPAC Name | (1R,7aR)-1-[(2R)-1-[(1S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-4-methylcyclopent-2-en-1-yl]propan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
| SMILES | C[C@H](C[C@@H]1C=C[C@](C)(O[Si](C)(C)C(C)(C)C)C1)[C@H]1CCC2C(=O)CCC[C@@]21C |
| InChI | InChI=1S/C25H44O2Si/c1-18(20-11-12-21-22(26)10-9-14-25(20,21)6)16-19-13-15-24(5,17-19)27-28(7,8)23(2,3)4/h13,15,18-21H,9-12,14,16-17H2,1-8H3/t18-,19+,20-,21?,24+,25-/m1/s1 |
| InChIKey | IESLDIWSAZKNBK-NGMDKCNOSA-N |
| XLogP | 7.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.71 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|