C11H18O8 — CID 57287790
2-[(2R,3S,4S)-1,2,3,6-tetrahydroxy-5-oxonon-8-en-4-yl]oxyacetic acid (PubChem CID 57287790) has the molecular formula C11H18O8 and a molecular weight of 278.26 g/mol. Its IUPAC name is 2-[(2R,3S,4S)-1,2,3,6-tetrahydroxy-5-oxonon-8-en-4-yl]oxyacetic acid.
| Compound Name | 2-[(2R,3S,4S)-1,2,3,6-tetrahydroxy-5-oxonon-8-en-4-yl]oxyacetic acid |
|---|---|
| PubChem CID | 57287790 |
| Molecular Formula | C11H18O8 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 2-[(2R,3S,4S)-1,2,3,6-tetrahydroxy-5-oxonon-8-en-4-yl]oxyacetic acid |
| SMILES | C=CCC(O)C(=O)[C@@H](OCC(=O)O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C11H18O8/c1-2-3-6(13)9(17)11(19-5-8(15)16)10(18)7(14)4-12/h2,6-7,10-14,18H,1,3-5H2,(H,15,16)/t6?,7-,10+,11-/m1/s1 |
| InChIKey | CUGCZPOEURRUAW-BJIWXTNOSA-N |
| XLogP | -2.32 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|