C26H37N3O2S3 — CID 57287879
4-[4-[3-[4,4-bis(ethylsulfanyl)-5-methoxy-3H-1,2-benzothiazin-2-yl]propyl]piperazin-1-yl]phenol (PubChem CID 57287879) has the molecular formula C26H37N3O2S3 and a molecular weight of 519.80 g/mol. Its IUPAC name is 4-[4-[3-[4,4-bis(ethylsulfanyl)-5-methoxy-3H-1,2-benzothiazin-2-yl]propyl]piperazin-1-yl]phenol.
| Compound Name | 4-[4-[3-[4,4-bis(ethylsulfanyl)-5-methoxy-3H-1,2-benzothiazin-2-yl]propyl]piperazin-1-yl]phenol |
|---|---|
| PubChem CID | 57287879 |
| Molecular Formula | C26H37N3O2S3 |
| Molecular Weight | 519.80 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | 4-[4-[3-[4,4-bis(ethylsulfanyl)-5-methoxy-3H-1,2-benzothiazin-2-yl]propyl]piperazin-1-yl]phenol |
| SMILES | CCSC1(SCC)CN(CCCN2CCN(c3ccc(O)cc3)CC2)Sc2cccc(OC)c21 |
| InChI | InChI=1S/C26H37N3O2S3/c1-4-32-26(33-5-2)20-29(34-24-9-6-8-23(31-3)25(24)26)15-7-14-27-16-18-28(19-17-27)21-10-12-22(30)13-11-21/h6,8-13,30H,4-5,7,14-20H2,1-3H3 |
| InChIKey | VIGRTZOYPDDUIC-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 39.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.80 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|