C17H18F3NO2 — CID 57288293
2-[2-methoxy-3-(trifluoromethyl)phenyl]-3-methylimino-5-prop-2-enylcyclopentan-1-one (PubChem CID 57288293) has the molecular formula C17H18F3NO2 and a molecular weight of 325.33 g/mol. Its IUPAC name is 2-[2-methoxy-3-(trifluoromethyl)phenyl]-3-methylimino-5-prop-2-enylcyclopentan-1-one.
| Compound Name | 2-[2-methoxy-3-(trifluoromethyl)phenyl]-3-methylimino-5-prop-2-enylcyclopentan-1-one |
|---|---|
| PubChem CID | 57288293 |
| Molecular Formula | C17H18F3NO2 |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 2-[2-methoxy-3-(trifluoromethyl)phenyl]-3-methylimino-5-prop-2-enylcyclopentan-1-one |
| SMILES | C=CCC1C/C(=N\C)C(c2cccc(C(F)(F)F)c2OC)C1=O |
| InChI | InChI=1S/C17H18F3NO2/c1-4-6-10-9-13(21-2)14(15(10)22)11-7-5-8-12(16(11)23-3)17(18,19)20/h4-5,7-8,10,14H,1,6,9H2,2-3H3/b21-13+ |
| InChIKey | FTECGEXJJCAOSY-FYJGNVAPSA-N |
| XLogP | 4.03 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|