About 6-azido-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylic acid
6-azido-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 57288701) has the molecular formula C7H6N4O4
and a molecular weight of 210.15 g/mol. Its IUPAC name is 6-azido-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
Molecular Properties
| Compound Name | 6-azido-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| PubChem CID | 57288701 |
| Molecular Formula | C7H6N4O4 |
| Molecular Weight | 210.15 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | 6-azido-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | [N-]=[N+]=NC1C(=O)N2C(C(=O)O)C(=O)CC12 |
| InChI | InChI=1S/C7H6N4O4/c8-10-9-4-2-1-3(12)5(7(14)15)11(2)6(4)13/h2,4-5H,1H2,(H,14,15) |
| InChIKey | XOTYEDXPXNVFET-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 123.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.15 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 6-azido-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-azido-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylic acid?
The IUPAC name of 6-azido-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (CID 57288701) is 6-azido-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
What is the SMILES notation for 6-azido-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylic acid?
The canonical SMILES for 6-azido-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylic acid is [N-]=[N+]=NC1C(=O)N2C(C(=O)O)C(=O)CC12.
What is the InChIKey of 6-azido-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylic acid?
The InChIKey is XOTYEDXPXNVFET-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N4O4/c8-10-9-4-2-1-3(12)5(7(14)15)11(2)6(4)13/h2,4-5H,1H2,(H,14,15).
What are the key properties of 6-azido-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylic acid?
6-azido-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylic acid has a molecular weight of 210.15 g/mol, XLogP of -0.70, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-azido-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylic acid is sourced from PubChem (CID 57288701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).