C18H27NO2 — CID 57288777
2,2,6,6-tetramethyl-1-(oxiran-2-ylmethyl)-4-phenoxypiperidine (PubChem CID 57288777) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-1-(oxiran-2-ylmethyl)-4-phenoxypiperidine.
| Compound Name | 2,2,6,6-tetramethyl-1-(oxiran-2-ylmethyl)-4-phenoxypiperidine |
|---|---|
| PubChem CID | 57288777 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 2,2,6,6-tetramethyl-1-(oxiran-2-ylmethyl)-4-phenoxypiperidine |
| SMILES | CC1(C)CC(Oc2ccccc2)CC(C)(C)N1CC1CO1 |
| InChI | InChI=1S/C18H27NO2/c1-17(2)10-15(21-14-8-6-5-7-9-14)11-18(3,4)19(17)12-16-13-20-16/h5-9,15-16H,10-13H2,1-4H3 |
| InChIKey | VCFHGXXCDXOFII-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 25.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|