About 1-[2-chloroethyl(dihydroxy)-λ4-sulfanyl]-4-(2-chloroethylsulfonyl)butane-2,3-dione
1-[2-chloroethyl(dihydroxy)-λ4-sulfanyl]-4-(2-chloroethylsulfonyl)butane-2,3-dione (PubChem CID 57289204) has the molecular formula C8H14Cl2O6S2
and a molecular weight of 341.23 g/mol. Its IUPAC name is 1-[2-chloroethyl(dihydroxy)-λ4-sulfanyl]-4-(2-chloroethylsulfonyl)butane-2,3-dione.
Molecular Properties
| Compound Name | 1-[2-chloroethyl(dihydroxy)-λ4-sulfanyl]-4-(2-chloroethylsulfonyl)butane-2,3-dione |
| PubChem CID | 57289204 |
| Molecular Formula | C8H14Cl2O6S2 |
| Molecular Weight | 341.23 g/mol |
| Exact Mass | 339.96 |
| IUPAC Name | 1-[2-chloroethyl(dihydroxy)-λ4-sulfanyl]-4-(2-chloroethylsulfonyl)butane-2,3-dione |
| SMILES | O=C(CS(O)(O)CCCl)C(=O)CS(=O)(=O)CCCl |
| InChI | InChI=1S/C8H14Cl2O6S2/c9-1-3-17(13,14)5-7(11)8(12)6-18(15,16)4-2-10/h13-14H,1-6H2 |
| InChIKey | ATDJERYBHRLXQL-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.23 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-chloroethyl(dihydroxy)-λ4-sulfanyl]-4-(2-chloroethylsulfonyl)butane-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-chloroethyl(dihydroxy)-λ4-sulfanyl]-4-(2-chloroethylsulfonyl)butane-2,3-dione?
The IUPAC name of 1-[2-chloroethyl(dihydroxy)-λ4-sulfanyl]-4-(2-chloroethylsulfonyl)butane-2,3-dione (CID 57289204) is 1-[2-chloroethyl(dihydroxy)-λ4-sulfanyl]-4-(2-chloroethylsulfonyl)butane-2,3-dione.
What is the SMILES notation for 1-[2-chloroethyl(dihydroxy)-λ4-sulfanyl]-4-(2-chloroethylsulfonyl)butane-2,3-dione?
The canonical SMILES for 1-[2-chloroethyl(dihydroxy)-λ4-sulfanyl]-4-(2-chloroethylsulfonyl)butane-2,3-dione is O=C(CS(O)(O)CCCl)C(=O)CS(=O)(=O)CCCl.
What is the InChIKey of 1-[2-chloroethyl(dihydroxy)-λ4-sulfanyl]-4-(2-chloroethylsulfonyl)butane-2,3-dione?
The InChIKey is ATDJERYBHRLXQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14Cl2O6S2/c9-1-3-17(13,14)5-7(11)8(12)6-18(15,16)4-2-10/h13-14H,1-6H2.
What are the key properties of 1-[2-chloroethyl(dihydroxy)-λ4-sulfanyl]-4-(2-chloroethylsulfonyl)butane-2,3-dione?
1-[2-chloroethyl(dihydroxy)-λ4-sulfanyl]-4-(2-chloroethylsulfonyl)butane-2,3-dione has a molecular weight of 341.23 g/mol, XLogP of 0.77, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-chloroethyl(dihydroxy)-λ4-sulfanyl]-4-(2-chloroethylsulfonyl)butane-2,3-dione is sourced from PubChem (CID 57289204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).