C15H28O2 — CID 57289443
3-cyclohexyl-1-cyclopentylbutane-1,3-diol (PubChem CID 57289443) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is 3-cyclohexyl-1-cyclopentylbutane-1,3-diol.
| Compound Name | 3-cyclohexyl-1-cyclopentylbutane-1,3-diol |
|---|---|
| PubChem CID | 57289443 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | 3-cyclohexyl-1-cyclopentylbutane-1,3-diol |
| SMILES | CC(O)(CC(O)C1CCCC1)C1CCCCC1 |
| InChI | InChI=1S/C15H28O2/c1-15(17,13-9-3-2-4-10-13)11-14(16)12-7-5-6-8-12/h12-14,16-17H,2-11H2,1H3 |
| InChIKey | MXKWHKKPCOODSX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |