C32H30N8O — CID 57289452
2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetraconta-1(37),3,6,9,14,16,21,23,25,27,32,34-dodecaen-5-one (PubChem CID 57289452) has the molecular formula C32H30N8O and a molecular weight of 542.65 g/mol. Its IUPAC name is 2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetraconta-1(37),3,6,9,14,16,21,23,25,27,32,34-dodecaen-5-one.
| Compound Name | 2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetraconta-1(37),3,6,9,14,16,21,23,25,27,32,34-dodecaen-5-one |
|---|---|
| PubChem CID | 57289452 |
| Molecular Formula | C32H30N8O |
| Molecular Weight | 542.65 g/mol |
| Exact Mass | 542.25 |
| IUPAC Name | 2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetraconta-1(37),3,6,9,14,16,21,23,25,27,32,34-dodecaen-5-one |
| SMILES | O=C1C=CCc2c3[nH]c(c21)NC1=NC(Nc2[nH]c(c4ccccc24)NC2NC(N3)C3C=CC=CC23)C2C=CC=CC12 |
| InChI | InChI=1S/C32H30N8O/c41-23-15-7-14-22-24(23)32-39-30-21-13-6-5-12-20(21)28(37-30)35-26-17-9-2-1-8-16(17)25(33-26)34-27-18-10-3-4-11-19(18)29(36-27)38-31(22)40-32/h1-13,15,18-21,27-29,33-36,38,40H,14H2,(H,37,39) |
| InChIKey | KVBWKEXTYYNDOB-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 121.16 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.65 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |