About (2S)-2-(methoxymethyl)-5,5-dimethylmorpholine
(2S)-2-(methoxymethyl)-5,5-dimethylmorpholine (PubChem CID 57289578) has the molecular formula C8H17NO2
and a molecular weight of 159.23 g/mol. Its IUPAC name is (2S)-2-(methoxymethyl)-5,5-dimethylmorpholine.
Molecular Properties
| Compound Name | (2S)-2-(methoxymethyl)-5,5-dimethylmorpholine |
| PubChem CID | 57289578 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | (2S)-2-(methoxymethyl)-5,5-dimethylmorpholine |
| SMILES | COC[C@@H]1CNC(C)(C)CO1 |
| InChI | InChI=1S/C8H17NO2/c1-8(2)6-11-7(4-9-8)5-10-3/h7,9H,4-6H2,1-3H3/t7-/m0/s1 |
| InChIKey | KBQZNIGTYCBNQE-ZETCQYMHSA-N |
| XLogP | 0.40 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-(methoxymethyl)-5,5-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(methoxymethyl)-5,5-dimethylmorpholine?
The IUPAC name of (2S)-2-(methoxymethyl)-5,5-dimethylmorpholine (CID 57289578) is (2S)-2-(methoxymethyl)-5,5-dimethylmorpholine.
What is the SMILES notation for (2S)-2-(methoxymethyl)-5,5-dimethylmorpholine?
The canonical SMILES for (2S)-2-(methoxymethyl)-5,5-dimethylmorpholine is COC[C@@H]1CNC(C)(C)CO1.
What is the InChIKey of (2S)-2-(methoxymethyl)-5,5-dimethylmorpholine?
The InChIKey is KBQZNIGTYCBNQE-ZETCQYMHSA-N. The full InChI is InChI=1S/C8H17NO2/c1-8(2)6-11-7(4-9-8)5-10-3/h7,9H,4-6H2,1-3H3/t7-/m0/s1.
What are the key properties of (2S)-2-(methoxymethyl)-5,5-dimethylmorpholine?
(2S)-2-(methoxymethyl)-5,5-dimethylmorpholine has a molecular weight of 159.23 g/mol, XLogP of 0.40, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(methoxymethyl)-5,5-dimethylmorpholine is sourced from PubChem (CID 57289578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).