C27H40FNO2 — CID 57289806
(8S,9S,13S,14S)-11-fluoro-7-[5-[3-hydroxypropyl(methyl)amino]pentyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 57289806) has the molecular formula C27H40FNO2 and a molecular weight of 429.62 g/mol. Its IUPAC name is (8S,9S,13S,14S)-11-fluoro-7-[5-[3-hydroxypropyl(methyl)amino]pentyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8S,9S,13S,14S)-11-fluoro-7-[5-[3-hydroxypropyl(methyl)amino]pentyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 57289806 |
| Molecular Formula | C27H40FNO2 |
| Molecular Weight | 429.62 g/mol |
| Exact Mass | 429.30 |
| IUPAC Name | (8S,9S,13S,14S)-11-fluoro-7-[5-[3-hydroxypropyl(methyl)amino]pentyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | CN(CCCO)CCCCCC1Cc2ccccc2[C@H]2C(F)C[C@]3(C)C(=O)CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C27H40FNO2/c1-27-18-23(28)26-21-11-6-5-9-19(21)17-20(25(26)22(27)12-13-24(27)31)10-4-3-7-14-29(2)15-8-16-30/h5-6,9,11,20,22-23,25-26,30H,3-4,7-8,10,12-18H2,1-2H3/t20?,22-,23?,25-,26-,27-/m0/s1 |
| InChIKey | GSLAUEXLEKCFBX-URONPTQJSA-N |
| XLogP | 5.16 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.62 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|