C22H34ClN3O6S — CID 57289933
(2S,3R)-3-[[(5-chloro-2-methoxyphenyl)sulfonyl-methylamino]methyl]-N-hydroxy-5-methyl-2-(piperidine-1-carbonyl)hexanamide (PubChem CID 57289933) has the molecular formula C22H34ClN3O6S and a molecular weight of 504.05 g/mol. Its IUPAC name is (2S,3R)-3-[[(5-chloro-2-methoxyphenyl)sulfonyl-methylamino]methyl]-N-hydroxy-5-methyl-2-(piperidine-1-carbonyl)hexanamide.
| Compound Name | (2S,3R)-3-[[(5-chloro-2-methoxyphenyl)sulfonyl-methylamino]methyl]-N-hydroxy-5-methyl-2-(piperidine-1-carbonyl)hexanamide |
|---|---|
| PubChem CID | 57289933 |
| Molecular Formula | C22H34ClN3O6S |
| Molecular Weight | 504.05 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | (2S,3R)-3-[[(5-chloro-2-methoxyphenyl)sulfonyl-methylamino]methyl]-N-hydroxy-5-methyl-2-(piperidine-1-carbonyl)hexanamide |
| SMILES | COc1ccc(Cl)cc1S(=O)(=O)N(C)C[C@H](CC(C)C)[C@H](C(=O)NO)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C22H34ClN3O6S/c1-15(2)12-16(20(21(27)24-29)22(28)26-10-6-5-7-11-26)14-25(3)33(30,31)19-13-17(23)8-9-18(19)32-4/h8-9,13,15-16,20,29H,5-7,10-12,14H2,1-4H3,(H,24,27)/t16-,20+/m0/s1 |
| InChIKey | ZVRZAZUYUYJNTL-OXJNMPFZSA-N |
| XLogP | 2.77 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.05 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|