About (2-chloroacetyl) 5-hydroxy-2-methylpent-2-enoate
(2-chloroacetyl) 5-hydroxy-2-methylpent-2-enoate (PubChem CID 57289986) has the molecular formula C8H11ClO4
and a molecular weight of 206.62 g/mol. Its IUPAC name is (2-chloroacetyl) 5-hydroxy-2-methylpent-2-enoate.
Molecular Properties
| Compound Name | (2-chloroacetyl) 5-hydroxy-2-methylpent-2-enoate |
| PubChem CID | 57289986 |
| Molecular Formula | C8H11ClO4 |
| Molecular Weight | 206.62 g/mol |
| Exact Mass | 206.03 |
| IUPAC Name | (2-chloroacetyl) 5-hydroxy-2-methylpent-2-enoate |
| SMILES | CC(=CCCO)C(=O)OC(=O)CCl |
| InChI | InChI=1S/C8H11ClO4/c1-6(3-2-4-10)8(12)13-7(11)5-9/h3,10H,2,4-5H2,1H3 |
| InChIKey | QDPYDFFONPEMHR-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.62 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2-chloroacetyl) 5-hydroxy-2-methylpent-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloroacetyl) 5-hydroxy-2-methylpent-2-enoate?
The IUPAC name of (2-chloroacetyl) 5-hydroxy-2-methylpent-2-enoate (CID 57289986) is (2-chloroacetyl) 5-hydroxy-2-methylpent-2-enoate.
What is the SMILES notation for (2-chloroacetyl) 5-hydroxy-2-methylpent-2-enoate?
The canonical SMILES for (2-chloroacetyl) 5-hydroxy-2-methylpent-2-enoate is CC(=CCCO)C(=O)OC(=O)CCl.
What is the InChIKey of (2-chloroacetyl) 5-hydroxy-2-methylpent-2-enoate?
The InChIKey is QDPYDFFONPEMHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11ClO4/c1-6(3-2-4-10)8(12)13-7(11)5-9/h3,10H,2,4-5H2,1H3.
What are the key properties of (2-chloroacetyl) 5-hydroxy-2-methylpent-2-enoate?
(2-chloroacetyl) 5-hydroxy-2-methylpent-2-enoate has a molecular weight of 206.62 g/mol, XLogP of 0.62, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloroacetyl) 5-hydroxy-2-methylpent-2-enoate is sourced from PubChem (CID 57289986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).