C26H40O3Si — CID 57290038
(8S,9R,10S,13S,14S,16S,17S)-3-methoxy-10,13,16-trimethyl-17-(2-trimethylsilylethynyl)-2,7,8,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-9,17-diol (PubChem CID 57290038) has the molecular formula C26H40O3Si and a molecular weight of 428.69 g/mol. Its IUPAC name is (8S,9R,10S,13S,14S,16S,17S)-3-methoxy-10,13,16-trimethyl-17-(2-trimethylsilylethynyl)-2,7,8,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-9,17-diol.
| Compound Name | (8S,9R,10S,13S,14S,16S,17S)-3-methoxy-10,13,16-trimethyl-17-(2-trimethylsilylethynyl)-2,7,8,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-9,17-diol |
|---|---|
| PubChem CID | 57290038 |
| Molecular Formula | C26H40O3Si |
| Molecular Weight | 428.69 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | (8S,9R,10S,13S,14S,16S,17S)-3-methoxy-10,13,16-trimethyl-17-(2-trimethylsilylethynyl)-2,7,8,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-9,17-diol |
| SMILES | COC1=CC2=CC[C@H]3[C@@H]4C[C@H](C)[C@@](O)(C#C[Si](C)(C)C)[C@@]4(C)CC[C@]3(O)[C@@]2(C)CC1 |
| InChI | InChI=1S/C26H40O3Si/c1-18-16-22-21-9-8-19-17-20(29-4)10-11-23(19,2)26(21,28)13-12-24(22,3)25(18,27)14-15-30(5,6)7/h8,17-18,21-22,27-28H,9-13,16H2,1-7H3/t18-,21-,22-,23-,24-,25-,26+/m0/s1 |
| InChIKey | AJHBHNKEWJLFGR-FKXPRRGESA-N |
| XLogP | 5.06 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.69 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|