About (4S)-1-amino-5-ethenyl-2,8-dimethylnonan-4-ol
(4S)-1-amino-5-ethenyl-2,8-dimethylnonan-4-ol (PubChem CID 57290122) has the molecular formula C13H27NO
and a molecular weight of 213.36 g/mol. Its IUPAC name is (4S)-1-amino-5-ethenyl-2,8-dimethylnonan-4-ol.
Molecular Properties
| Compound Name | (4S)-1-amino-5-ethenyl-2,8-dimethylnonan-4-ol |
| PubChem CID | 57290122 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | (4S)-1-amino-5-ethenyl-2,8-dimethylnonan-4-ol |
| SMILES | C=CC(CCC(C)C)[C@@H](O)CC(C)CN |
| InChI | InChI=1S/C13H27NO/c1-5-12(7-6-10(2)3)13(15)8-11(4)9-14/h5,10-13,15H,1,6-9,14H2,2-4H3/t11?,12?,13-/m0/s1 |
| InChIKey | UPUJVBMQZKJRIP-BPCQOVAHSA-N |
| XLogP | 2.57 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4S)-1-amino-5-ethenyl-2,8-dimethylnonan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-1-amino-5-ethenyl-2,8-dimethylnonan-4-ol?
The IUPAC name of (4S)-1-amino-5-ethenyl-2,8-dimethylnonan-4-ol (CID 57290122) is (4S)-1-amino-5-ethenyl-2,8-dimethylnonan-4-ol.
What is the SMILES notation for (4S)-1-amino-5-ethenyl-2,8-dimethylnonan-4-ol?
The canonical SMILES for (4S)-1-amino-5-ethenyl-2,8-dimethylnonan-4-ol is C=CC(CCC(C)C)[C@@H](O)CC(C)CN.
What is the InChIKey of (4S)-1-amino-5-ethenyl-2,8-dimethylnonan-4-ol?
The InChIKey is UPUJVBMQZKJRIP-BPCQOVAHSA-N. The full InChI is InChI=1S/C13H27NO/c1-5-12(7-6-10(2)3)13(15)8-11(4)9-14/h5,10-13,15H,1,6-9,14H2,2-4H3/t11?,12?,13-/m0/s1.
What are the key properties of (4S)-1-amino-5-ethenyl-2,8-dimethylnonan-4-ol?
(4S)-1-amino-5-ethenyl-2,8-dimethylnonan-4-ol has a molecular weight of 213.36 g/mol, XLogP of 2.57, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-1-amino-5-ethenyl-2,8-dimethylnonan-4-ol is sourced from PubChem (CID 57290122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).