About methyl 3-formyl-2H-1,3-thiazole-2-carboxylate
methyl 3-formyl-2H-1,3-thiazole-2-carboxylate (PubChem CID 57290458) has the molecular formula C6H7NO3S
and a molecular weight of 173.19 g/mol. Its IUPAC name is methyl 3-formyl-2H-1,3-thiazole-2-carboxylate.
Molecular Properties
| Compound Name | methyl 3-formyl-2H-1,3-thiazole-2-carboxylate |
| PubChem CID | 57290458 |
| Molecular Formula | C6H7NO3S |
| Molecular Weight | 173.19 g/mol |
| Exact Mass | 173.01 |
| IUPAC Name | methyl 3-formyl-2H-1,3-thiazole-2-carboxylate |
| SMILES | COC(=O)C1SC=CN1C=O |
| InChI | InChI=1S/C6H7NO3S/c1-10-6(9)5-7(4-8)2-3-11-5/h2-5H,1H3 |
| InChIKey | PIMMJFODTUMGGF-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.19 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-formyl-2H-1,3-thiazole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-formyl-2H-1,3-thiazole-2-carboxylate?
The IUPAC name of methyl 3-formyl-2H-1,3-thiazole-2-carboxylate (CID 57290458) is methyl 3-formyl-2H-1,3-thiazole-2-carboxylate.
What is the SMILES notation for methyl 3-formyl-2H-1,3-thiazole-2-carboxylate?
The canonical SMILES for methyl 3-formyl-2H-1,3-thiazole-2-carboxylate is COC(=O)C1SC=CN1C=O.
What is the InChIKey of methyl 3-formyl-2H-1,3-thiazole-2-carboxylate?
The InChIKey is PIMMJFODTUMGGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO3S/c1-10-6(9)5-7(4-8)2-3-11-5/h2-5H,1H3.
What are the key properties of methyl 3-formyl-2H-1,3-thiazole-2-carboxylate?
methyl 3-formyl-2H-1,3-thiazole-2-carboxylate has a molecular weight of 173.19 g/mol, XLogP of 0.16, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-formyl-2H-1,3-thiazole-2-carboxylate is sourced from PubChem (CID 57290458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).