About prop-2-enyl prop-2-ene-1-sulfinate
prop-2-enyl prop-2-ene-1-sulfinate (PubChem CID 57291063) has the molecular formula C6H10O2S
and a molecular weight of 146.21 g/mol. Its IUPAC name is prop-2-enyl prop-2-ene-1-sulfinate.
Molecular Properties
| Compound Name | prop-2-enyl prop-2-ene-1-sulfinate |
| PubChem CID | 57291063 |
| Molecular Formula | C6H10O2S |
| Molecular Weight | 146.21 g/mol |
| Exact Mass | 146.04 |
| IUPAC Name | prop-2-enyl prop-2-ene-1-sulfinate |
| SMILES | C=CCOS(=O)CC=C |
| InChI | InChI=1S/C6H10O2S/c1-3-5-8-9(7)6-4-2/h3-4H,1-2,5-6H2 |
| InChIKey | NXNSSVXQEWDXSS-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.21 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl prop-2-ene-1-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl prop-2-ene-1-sulfinate?
The IUPAC name of prop-2-enyl prop-2-ene-1-sulfinate (CID 57291063) is prop-2-enyl prop-2-ene-1-sulfinate.
What is the SMILES notation for prop-2-enyl prop-2-ene-1-sulfinate?
The canonical SMILES for prop-2-enyl prop-2-ene-1-sulfinate is C=CCOS(=O)CC=C.
What is the InChIKey of prop-2-enyl prop-2-ene-1-sulfinate?
The InChIKey is NXNSSVXQEWDXSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2S/c1-3-5-8-9(7)6-4-2/h3-4H,1-2,5-6H2.
What are the key properties of prop-2-enyl prop-2-ene-1-sulfinate?
prop-2-enyl prop-2-ene-1-sulfinate has a molecular weight of 146.21 g/mol, XLogP of 1.04, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl prop-2-ene-1-sulfinate is sourced from PubChem (CID 57291063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).