C13H23N3O — CID 57291172
(3S)-3-[1-(2-ethoxyethyl)imidazol-2-yl]-1-methylpiperidine (PubChem CID 57291172) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is (3S)-3-[1-(2-ethoxyethyl)imidazol-2-yl]-1-methylpiperidine.
| Compound Name | (3S)-3-[1-(2-ethoxyethyl)imidazol-2-yl]-1-methylpiperidine |
|---|---|
| PubChem CID | 57291172 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | (3S)-3-[1-(2-ethoxyethyl)imidazol-2-yl]-1-methylpiperidine |
| SMILES | CCOCCn1ccnc1[C@H]1CCCN(C)C1 |
| InChI | InChI=1S/C13H23N3O/c1-3-17-10-9-16-8-6-14-13(16)12-5-4-7-15(2)11-12/h6,8,12H,3-5,7,9-11H2,1-2H3/t12-/m0/s1 |
| InChIKey | NYFFZUFJSUGXPE-LBPRGKRZSA-N |
| XLogP | 1.73 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|