C8H14O2 — CID 57291206
4,4-diethoxybuta-1,2-diene (PubChem CID 57291206) has the molecular formula C8H14O2 and a molecular weight of 142.20 g/mol. Its IUPAC name is 4,4-diethoxybuta-1,2-diene.
| Compound Name | 4,4-diethoxybuta-1,2-diene |
|---|---|
| PubChem CID | 57291206 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | 4,4-diethoxybuta-1,2-diene |
| SMILES | C=C=CC(OCC)OCC |
| InChI | InChI=1S/C8H14O2/c1-4-7-8(9-5-2)10-6-3/h7-8H,1,5-6H2,2-3H3 |
| InChIKey | BJKXEUVTEFXZPL-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|