C5H7NO3 — CID 57291578
methyl 2,5-dihydro-1,2-oxazole-3-carboxylate (PubChem CID 57291578) has the molecular formula C5H7NO3 and a molecular weight of 129.11 g/mol. Its IUPAC name is methyl 2,5-dihydro-1,2-oxazole-3-carboxylate.
| Compound Name | methyl 2,5-dihydro-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 57291578 |
| Molecular Formula | C5H7NO3 |
| Molecular Weight | 129.11 g/mol |
| Exact Mass | 129.04 |
| IUPAC Name | methyl 2,5-dihydro-1,2-oxazole-3-carboxylate |
| SMILES | COC(=O)C1=CCON1 |
| InChI | InChI=1S/C5H7NO3/c1-8-5(7)4-2-3-9-6-4/h2,6H,3H2,1H3 |
| InChIKey | GZPSURUBGKYSBU-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.11 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |