About 2-ethyl-N,N-bis(3-hydroxy-2,2-dimethylpropyl)hexanamide
2-ethyl-N,N-bis(3-hydroxy-2,2-dimethylpropyl)hexanamide (PubChem CID 57291591) has the molecular formula C18H37NO3
and a molecular weight of 315.50 g/mol. Its IUPAC name is 2-ethyl-N,N-bis(3-hydroxy-2,2-dimethylpropyl)hexanamide.
Molecular Properties
| Compound Name | 2-ethyl-N,N-bis(3-hydroxy-2,2-dimethylpropyl)hexanamide |
| PubChem CID | 57291591 |
| Molecular Formula | C18H37NO3 |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.28 |
| IUPAC Name | 2-ethyl-N,N-bis(3-hydroxy-2,2-dimethylpropyl)hexanamide |
| SMILES | CCCCC(CC)C(=O)N(CC(C)(C)CO)CC(C)(C)CO |
| InChI | InChI=1S/C18H37NO3/c1-7-9-10-15(8-2)16(22)19(11-17(3,4)13-20)12-18(5,6)14-21/h15,20-21H,7-14H2,1-6H3 |
| InChIKey | KDINASPKPJKNDM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethyl-N,N-bis(3-hydroxy-2,2-dimethylpropyl)hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-N,N-bis(3-hydroxy-2,2-dimethylpropyl)hexanamide?
The IUPAC name of 2-ethyl-N,N-bis(3-hydroxy-2,2-dimethylpropyl)hexanamide (CID 57291591) is 2-ethyl-N,N-bis(3-hydroxy-2,2-dimethylpropyl)hexanamide.
What is the SMILES notation for 2-ethyl-N,N-bis(3-hydroxy-2,2-dimethylpropyl)hexanamide?
The canonical SMILES for 2-ethyl-N,N-bis(3-hydroxy-2,2-dimethylpropyl)hexanamide is CCCCC(CC)C(=O)N(CC(C)(C)CO)CC(C)(C)CO.
What is the InChIKey of 2-ethyl-N,N-bis(3-hydroxy-2,2-dimethylpropyl)hexanamide?
The InChIKey is KDINASPKPJKNDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H37NO3/c1-7-9-10-15(8-2)16(22)19(11-17(3,4)13-20)12-18(5,6)14-21/h15,20-21H,7-14H2,1-6H3.
What are the key properties of 2-ethyl-N,N-bis(3-hydroxy-2,2-dimethylpropyl)hexanamide?
2-ethyl-N,N-bis(3-hydroxy-2,2-dimethylpropyl)hexanamide has a molecular weight of 315.50 g/mol, XLogP of 3.07, 11 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-N,N-bis(3-hydroxy-2,2-dimethylpropyl)hexanamide is sourced from PubChem (CID 57291591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).