C21H28N2O — CID 57291928
3-[1-(6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)-3-(methylamino)propan-2-yl]aniline (PubChem CID 57291928) has the molecular formula C21H28N2O and a molecular weight of 324.47 g/mol. Its IUPAC name is 3-[1-(6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)-3-(methylamino)propan-2-yl]aniline.
| Compound Name | 3-[1-(6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)-3-(methylamino)propan-2-yl]aniline |
|---|---|
| PubChem CID | 57291928 |
| Molecular Formula | C21H28N2O |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | 3-[1-(6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)-3-(methylamino)propan-2-yl]aniline |
| SMILES | CNCC(CC1CCCc2cc(OC)ccc21)c1cccc(N)c1 |
| InChI | InChI=1S/C21H28N2O/c1-23-14-18(15-5-4-8-19(22)12-15)11-16-6-3-7-17-13-20(24-2)9-10-21(16)17/h4-5,8-10,12-13,16,18,23H,3,6-7,11,14,22H2,1-2H3 |
| InChIKey | ZMLKDMTYTBNUNT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|