About 1,3-diethyl-1-sulfanylurea
1,3-diethyl-1-sulfanylurea (PubChem CID 57292157) has the molecular formula C5H12N2OS
and a molecular weight of 148.23 g/mol. Its IUPAC name is 1,3-diethyl-1-sulfanylurea.
Molecular Properties
| Compound Name | 1,3-diethyl-1-sulfanylurea |
| PubChem CID | 57292157 |
| Molecular Formula | C5H12N2OS |
| Molecular Weight | 148.23 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | 1,3-diethyl-1-sulfanylurea |
| SMILES | CCNC(=O)N(S)CC |
| InChI | InChI=1S/C5H12N2OS/c1-3-6-5(8)7(9)4-2/h9H,3-4H2,1-2H3,(H,6,8) |
| InChIKey | MQSOVMUGSBVNHA-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.23 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1,3-diethyl-1-sulfanylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-diethyl-1-sulfanylurea?
The IUPAC name of 1,3-diethyl-1-sulfanylurea (CID 57292157) is 1,3-diethyl-1-sulfanylurea.
What is the SMILES notation for 1,3-diethyl-1-sulfanylurea?
The canonical SMILES for 1,3-diethyl-1-sulfanylurea is CCNC(=O)N(S)CC.
What is the InChIKey of 1,3-diethyl-1-sulfanylurea?
The InChIKey is MQSOVMUGSBVNHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2OS/c1-3-6-5(8)7(9)4-2/h9H,3-4H2,1-2H3,(H,6,8).
What are the key properties of 1,3-diethyl-1-sulfanylurea?
1,3-diethyl-1-sulfanylurea has a molecular weight of 148.23 g/mol, XLogP of 0.88, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-diethyl-1-sulfanylurea is sourced from PubChem (CID 57292157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).