About 5-methyl-N-phenyl-4,5-dihydro-1H-imidazol-2-amine
5-methyl-N-phenyl-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 57292286) has the molecular formula C10H13N3
and a molecular weight of 175.24 g/mol. Its IUPAC name is 5-methyl-N-phenyl-4,5-dihydro-1H-imidazol-2-amine.
Molecular Properties
| Compound Name | 5-methyl-N-phenyl-4,5-dihydro-1H-imidazol-2-amine |
| PubChem CID | 57292286 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.24 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 5-methyl-N-phenyl-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | CC1CN=C(Nc2ccccc2)N1 |
| InChI | InChI=1S/C10H13N3/c1-8-7-11-10(12-8)13-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H2,11,12,13) |
| InChIKey | SOWJLGVVZAKLNG-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.24 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methyl-N-phenyl-4,5-dihydro-1H-imidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-N-phenyl-4,5-dihydro-1H-imidazol-2-amine?
The IUPAC name of 5-methyl-N-phenyl-4,5-dihydro-1H-imidazol-2-amine (CID 57292286) is 5-methyl-N-phenyl-4,5-dihydro-1H-imidazol-2-amine.
What is the SMILES notation for 5-methyl-N-phenyl-4,5-dihydro-1H-imidazol-2-amine?
The canonical SMILES for 5-methyl-N-phenyl-4,5-dihydro-1H-imidazol-2-amine is CC1CN=C(Nc2ccccc2)N1.
What is the InChIKey of 5-methyl-N-phenyl-4,5-dihydro-1H-imidazol-2-amine?
The InChIKey is SOWJLGVVZAKLNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3/c1-8-7-11-10(12-8)13-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H2,11,12,13).
What are the key properties of 5-methyl-N-phenyl-4,5-dihydro-1H-imidazol-2-amine?
5-methyl-N-phenyl-4,5-dihydro-1H-imidazol-2-amine has a molecular weight of 175.24 g/mol, XLogP of 1.45, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-N-phenyl-4,5-dihydro-1H-imidazol-2-amine is sourced from PubChem (CID 57292286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).