About 2-fluoro-4-nonylbenzoic acid
2-fluoro-4-nonylbenzoic acid (PubChem CID 57292315) has the molecular formula C16H23FO2
and a molecular weight of 266.36 g/mol. Its IUPAC name is 2-fluoro-4-nonylbenzoic acid.
Molecular Properties
| Compound Name | 2-fluoro-4-nonylbenzoic acid |
| PubChem CID | 57292315 |
| Molecular Formula | C16H23FO2 |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 2-fluoro-4-nonylbenzoic acid |
| SMILES | CCCCCCCCCc1ccc(C(=O)O)c(F)c1 |
| InChI | InChI=1S/C16H23FO2/c1-2-3-4-5-6-7-8-9-13-10-11-14(16(18)19)15(17)12-13/h10-12H,2-9H2,1H3,(H,18,19) |
| InChIKey | KOCJOWJGNINPAT-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-4-nonylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-4-nonylbenzoic acid?
The IUPAC name of 2-fluoro-4-nonylbenzoic acid (CID 57292315) is 2-fluoro-4-nonylbenzoic acid.
What is the SMILES notation for 2-fluoro-4-nonylbenzoic acid?
The canonical SMILES for 2-fluoro-4-nonylbenzoic acid is CCCCCCCCCc1ccc(C(=O)O)c(F)c1.
What is the InChIKey of 2-fluoro-4-nonylbenzoic acid?
The InChIKey is KOCJOWJGNINPAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23FO2/c1-2-3-4-5-6-7-8-9-13-10-11-14(16(18)19)15(17)12-13/h10-12H,2-9H2,1H3,(H,18,19).
What are the key properties of 2-fluoro-4-nonylbenzoic acid?
2-fluoro-4-nonylbenzoic acid has a molecular weight of 266.36 g/mol, XLogP of 4.82, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-4-nonylbenzoic acid is sourced from PubChem (CID 57292315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).