C23H33BrO4 — CID 57292700
4-bromo-4-[(8R,9S,10R,13S,14S,17R)-17-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoic acid (PubChem CID 57292700) has the molecular formula C23H33BrO4 and a molecular weight of 453.42 g/mol. Its IUPAC name is 4-bromo-4-[(8R,9S,10R,13S,14S,17R)-17-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoic acid.
| Compound Name | 4-bromo-4-[(8R,9S,10R,13S,14S,17R)-17-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoic acid |
|---|---|
| PubChem CID | 57292700 |
| Molecular Formula | C23H33BrO4 |
| Molecular Weight | 453.42 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | 4-bromo-4-[(8R,9S,10R,13S,14S,17R)-17-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoic acid |
| SMILES | C[C@]12CCC(=O)C=C1CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@]2(O)C(Br)CCC(=O)O |
| InChI | InChI=1S/C23H33BrO4/c1-21-10-7-15(25)13-14(21)3-4-16-17(21)8-11-22(2)18(16)9-12-23(22,28)19(24)5-6-20(26)27/h13,16-19,28H,3-12H2,1-2H3,(H,26,27)/t16-,17+,18+,19?,21+,22+,23+/m1/s1 |
| InChIKey | SJIZTUYKPGTSIV-BBKCLMRWSA-N |
| XLogP | 4.88 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.42 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|