C16H22N2 — CID 57293262
10,16-dimethyl-2,9-diazatetracyclo[8.5.1.03,14.05,12]hexadeca-2,5(12),6-triene (PubChem CID 57293262) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 10,16-dimethyl-2,9-diazatetracyclo[8.5.1.03,14.05,12]hexadeca-2,5(12),6-triene.
| Compound Name | 10,16-dimethyl-2,9-diazatetracyclo[8.5.1.03,14.05,12]hexadeca-2,5(12),6-triene |
|---|---|
| PubChem CID | 57293262 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 10,16-dimethyl-2,9-diazatetracyclo[8.5.1.03,14.05,12]hexadeca-2,5(12),6-triene |
| SMILES | CC1C2CC3CC4=C(C=CCNC1(C)C4)CC3=N2 |
| InChI | InChI=1S/C16H22N2/c1-10-14-8-12-6-13-9-16(10,2)17-5-3-4-11(13)7-15(12)18-14/h3-4,10,12,14,17H,5-9H2,1-2H3 |
| InChIKey | JYLDCNFYBYZIRJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |