C5H4F4 — CID 57293288
1,1,2,3-tetrafluoropenta-1,3-diene (PubChem CID 57293288) has the molecular formula C5H4F4 and a molecular weight of 140.08 g/mol. Its IUPAC name is 1,1,2,3-tetrafluoropenta-1,3-diene.
| Compound Name | 1,1,2,3-tetrafluoropenta-1,3-diene |
|---|---|
| PubChem CID | 57293288 |
| Molecular Formula | C5H4F4 |
| Molecular Weight | 140.08 g/mol |
| Exact Mass | 140.02 |
| IUPAC Name | 1,1,2,3-tetrafluoropenta-1,3-diene |
| SMILES | CC=C(F)C(F)=C(F)F |
| InChI | InChI=1S/C5H4F4/c1-2-3(6)4(7)5(8)9/h2H,1H3 |
| InChIKey | UBTUSCPZZQRQLT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.08 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|