C20H33FO4Si — CID 57293323
(2R,3S,4R,5S,6S)-3-benzyl-4-[tert-butyl(dimethyl)silyl]-5-fluoro-6-methoxy-2-methyloxane-3,4-diol (PubChem CID 57293323) has the molecular formula C20H33FO4Si and a molecular weight of 384.56 g/mol. Its IUPAC name is (2R,3S,4R,5S,6S)-3-benzyl-4-[tert-butyl(dimethyl)silyl]-5-fluoro-6-methoxy-2-methyloxane-3,4-diol.
| Compound Name | (2R,3S,4R,5S,6S)-3-benzyl-4-[tert-butyl(dimethyl)silyl]-5-fluoro-6-methoxy-2-methyloxane-3,4-diol |
|---|---|
| PubChem CID | 57293323 |
| Molecular Formula | C20H33FO4Si |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | (2R,3S,4R,5S,6S)-3-benzyl-4-[tert-butyl(dimethyl)silyl]-5-fluoro-6-methoxy-2-methyloxane-3,4-diol |
| SMILES | CO[C@H]1O[C@H](C)[C@@](O)(Cc2ccccc2)[C@@](O)([Si](C)(C)C(C)(C)C)[C@H]1F |
| InChI | InChI=1S/C20H33FO4Si/c1-14-19(22,13-15-11-9-8-10-12-15)20(23,16(21)17(24-5)25-14)26(6,7)18(2,3)4/h8-12,14,16-17,22-23H,13H2,1-7H3/t14-,16+,17+,19+,20+/m1/s1 |
| InChIKey | BEDWMYMPDDAJME-GVJFSJSTSA-N |
| XLogP | 3.47 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|