C20H28N2O3 — CID 57293674
[(4aR,5R,6S)-1,3,4a,5-tetramethyl-2-oxo-4,5,6,7-tetrahydrobenzo[f]indol-6-yl] N-propylcarbamate (PubChem CID 57293674) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is [(4aR,5R,6S)-1,3,4a,5-tetramethyl-2-oxo-4,5,6,7-tetrahydrobenzo[f]indol-6-yl] N-propylcarbamate.
| Compound Name | [(4aR,5R,6S)-1,3,4a,5-tetramethyl-2-oxo-4,5,6,7-tetrahydrobenzo[f]indol-6-yl] N-propylcarbamate |
|---|---|
| PubChem CID | 57293674 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | [(4aR,5R,6S)-1,3,4a,5-tetramethyl-2-oxo-4,5,6,7-tetrahydrobenzo[f]indol-6-yl] N-propylcarbamate |
| SMILES | CCCNC(=O)O[C@H]1CC=C2C=C3C(=C(C)C(=O)N3C)C[C@]2(C)[C@H]1C |
| InChI | InChI=1S/C20H28N2O3/c1-6-9-21-19(24)25-17-8-7-14-10-16-15(11-20(14,4)13(17)3)12(2)18(23)22(16)5/h7,10,13,17H,6,8-9,11H2,1-5H3,(H,21,24)/t13-,17-,20+/m0/s1 |
| InChIKey | RLCBLKVEWYJSFY-QKMWGZLOSA-N |
| XLogP | 3.54 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |