C45H50N2O8 — CID 57294094
ditert-butyl (2R)-2-[[(2S,3S)-6-(1,3-benzoxazol-2-yl)-3-(4-methoxycarbonylphenyl)hex-5-en-2-yl]-(naphthalen-2-ylmethyl)carbamoyl]butanedioate (PubChem CID 57294094) has the molecular formula C45H50N2O8 and a molecular weight of 746.90 g/mol. Its IUPAC name is ditert-butyl (2R)-2-[[(2S,3S)-6-(1,3-benzoxazol-2-yl)-3-(4-methoxycarbonylphenyl)hex-5-en-2-yl]-(naphthalen-2-ylmethyl)carbamoyl]butanedioate.
| Compound Name | ditert-butyl (2R)-2-[[(2S,3S)-6-(1,3-benzoxazol-2-yl)-3-(4-methoxycarbonylphenyl)hex-5-en-2-yl]-(naphthalen-2-ylmethyl)carbamoyl]butanedioate |
|---|---|
| PubChem CID | 57294094 |
| Molecular Formula | C45H50N2O8 |
| Molecular Weight | 746.90 g/mol |
| Exact Mass | 746.36 |
| IUPAC Name | ditert-butyl (2R)-2-[[(2S,3S)-6-(1,3-benzoxazol-2-yl)-3-(4-methoxycarbonylphenyl)hex-5-en-2-yl]-(naphthalen-2-ylmethyl)carbamoyl]butanedioate |
| SMILES | COC(=O)c1ccc([C@H](CC=Cc2nc3ccccc3o2)[C@H](C)N(Cc2ccc3ccccc3c2)C(=O)[C@@H](CC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C45H50N2O8/c1-29(35(32-22-24-33(25-23-32)42(50)52-8)16-13-19-39-46-37-17-11-12-18-38(37)53-39)47(28-30-20-21-31-14-9-10-15-34(31)26-30)41(49)36(43(51)55-45(5,6)7)27-40(48)54-44(2,3)4/h9-15,17-26,29,35-36H,16,27-28H2,1-8H3/t29-,35+,36+/m0/s1 |
| InChIKey | MKDZBRRZWGVBNG-BXQIBZSOSA-N |
| XLogP | 9.06 |
| TPSA | 125.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.90 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|