About 3-(3-cyano-4-fluorophenyl)-5-(methanesulfonamidomethyl)-2H-1,2-oxazole-5-carboxylic acid
3-(3-cyano-4-fluorophenyl)-5-(methanesulfonamidomethyl)-2H-1,2-oxazole-5-carboxylic acid (PubChem CID 57294190) has the molecular formula C13H12FN3O5S
and a molecular weight of 341.32 g/mol. Its IUPAC name is 3-(3-cyano-4-fluorophenyl)-5-(methanesulfonamidomethyl)-2H-1,2-oxazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 3-(3-cyano-4-fluorophenyl)-5-(methanesulfonamidomethyl)-2H-1,2-oxazole-5-carboxylic acid |
| PubChem CID | 57294190 |
| Molecular Formula | C13H12FN3O5S |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 3-(3-cyano-4-fluorophenyl)-5-(methanesulfonamidomethyl)-2H-1,2-oxazole-5-carboxylic acid |
| SMILES | CS(=O)(=O)NCC1(C(=O)O)C=C(c2ccc(F)c(C#N)c2)NO1 |
| InChI | InChI=1S/C13H12FN3O5S/c1-23(20,21)16-7-13(12(18)19)5-11(17-22-13)8-2-3-10(14)9(4-8)6-15/h2-5,16-17H,7H2,1H3,(H,18,19) |
| InChIKey | IGTFFQQWQFWMRY-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 128.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(3-cyano-4-fluorophenyl)-5-(methanesulfonamidomethyl)-2H-1,2-oxazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-cyano-4-fluorophenyl)-5-(methanesulfonamidomethyl)-2H-1,2-oxazole-5-carboxylic acid?
The IUPAC name of 3-(3-cyano-4-fluorophenyl)-5-(methanesulfonamidomethyl)-2H-1,2-oxazole-5-carboxylic acid (CID 57294190) is 3-(3-cyano-4-fluorophenyl)-5-(methanesulfonamidomethyl)-2H-1,2-oxazole-5-carboxylic acid.
What is the SMILES notation for 3-(3-cyano-4-fluorophenyl)-5-(methanesulfonamidomethyl)-2H-1,2-oxazole-5-carboxylic acid?
The canonical SMILES for 3-(3-cyano-4-fluorophenyl)-5-(methanesulfonamidomethyl)-2H-1,2-oxazole-5-carboxylic acid is CS(=O)(=O)NCC1(C(=O)O)C=C(c2ccc(F)c(C#N)c2)NO1.
What is the InChIKey of 3-(3-cyano-4-fluorophenyl)-5-(methanesulfonamidomethyl)-2H-1,2-oxazole-5-carboxylic acid?
The InChIKey is IGTFFQQWQFWMRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12FN3O5S/c1-23(20,21)16-7-13(12(18)19)5-11(17-22-13)8-2-3-10(14)9(4-8)6-15/h2-5,16-17H,7H2,1H3,(H,18,19).
What are the key properties of 3-(3-cyano-4-fluorophenyl)-5-(methanesulfonamidomethyl)-2H-1,2-oxazole-5-carboxylic acid?
3-(3-cyano-4-fluorophenyl)-5-(methanesulfonamidomethyl)-2H-1,2-oxazole-5-carboxylic acid has a molecular weight of 341.32 g/mol, XLogP of -0.05, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-cyano-4-fluorophenyl)-5-(methanesulfonamidomethyl)-2H-1,2-oxazole-5-carboxylic acid is sourced from PubChem (CID 57294190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).