About 3-methoxy-5,6-dimethylcyclohex-5-ene-1,2,4-trione
3-methoxy-5,6-dimethylcyclohex-5-ene-1,2,4-trione (PubChem CID 57294318) has the molecular formula C9H10O4
and a molecular weight of 182.17 g/mol. Its IUPAC name is 3-methoxy-5,6-dimethylcyclohex-5-ene-1,2,4-trione.
Molecular Properties
| Compound Name | 3-methoxy-5,6-dimethylcyclohex-5-ene-1,2,4-trione |
| PubChem CID | 57294318 |
| Molecular Formula | C9H10O4 |
| Molecular Weight | 182.17 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | 3-methoxy-5,6-dimethylcyclohex-5-ene-1,2,4-trione |
| SMILES | COC1C(=O)C(=O)C(C)=C(C)C1=O |
| InChI | InChI=1S/C9H10O4/c1-4-5(2)7(11)9(13-3)8(12)6(4)10/h9H,1-3H3 |
| InChIKey | REIMEOFUMKNBML-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.17 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxy-5,6-dimethylcyclohex-5-ene-1,2,4-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-5,6-dimethylcyclohex-5-ene-1,2,4-trione?
The IUPAC name of 3-methoxy-5,6-dimethylcyclohex-5-ene-1,2,4-trione (CID 57294318) is 3-methoxy-5,6-dimethylcyclohex-5-ene-1,2,4-trione.
What is the SMILES notation for 3-methoxy-5,6-dimethylcyclohex-5-ene-1,2,4-trione?
The canonical SMILES for 3-methoxy-5,6-dimethylcyclohex-5-ene-1,2,4-trione is COC1C(=O)C(=O)C(C)=C(C)C1=O.
What is the InChIKey of 3-methoxy-5,6-dimethylcyclohex-5-ene-1,2,4-trione?
The InChIKey is REIMEOFUMKNBML-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O4/c1-4-5(2)7(11)9(13-3)8(12)6(4)10/h9H,1-3H3.
What are the key properties of 3-methoxy-5,6-dimethylcyclohex-5-ene-1,2,4-trione?
3-methoxy-5,6-dimethylcyclohex-5-ene-1,2,4-trione has a molecular weight of 182.17 g/mol, XLogP of 0.06, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-5,6-dimethylcyclohex-5-ene-1,2,4-trione is sourced from PubChem (CID 57294318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).