C16H16N4O — CID 57294772
2-methyl-5-(4,5,6,7-tetrahydro-1H-indol-2-ylmethylidene)-7H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 57294772) has the molecular formula C16H16N4O and a molecular weight of 280.33 g/mol. Its IUPAC name is 2-methyl-5-(4,5,6,7-tetrahydro-1H-indol-2-ylmethylidene)-7H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 2-methyl-5-(4,5,6,7-tetrahydro-1H-indol-2-ylmethylidene)-7H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 57294772 |
| Molecular Formula | C16H16N4O |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 2-methyl-5-(4,5,6,7-tetrahydro-1H-indol-2-ylmethylidene)-7H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | Cc1ncc2c(n1)NC(=O)C2=Cc1cc2c([nH]1)CCCC2 |
| InChI | InChI=1S/C16H16N4O/c1-9-17-8-13-12(16(21)20-15(13)18-9)7-11-6-10-4-2-3-5-14(10)19-11/h6-8,19H,2-5H2,1H3,(H,17,18,20,21) |
| InChIKey | YZSSNTCHOKCKMF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|