C37H61N3O6 — CID 57295121
3-[2-[(1-octylcyclohexyl)carbamoylamino]cyclohexyl]-3-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]propanoic acid (PubChem CID 57295121) has the molecular formula C37H61N3O6 and a molecular weight of 643.91 g/mol. Its IUPAC name is 3-[2-[(1-octylcyclohexyl)carbamoylamino]cyclohexyl]-3-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]propanoic acid.
| Compound Name | 3-[2-[(1-octylcyclohexyl)carbamoylamino]cyclohexyl]-3-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 57295121 |
| Molecular Formula | C37H61N3O6 |
| Molecular Weight | 643.91 g/mol |
| Exact Mass | 643.46 |
| IUPAC Name | 3-[2-[(1-octylcyclohexyl)carbamoylamino]cyclohexyl]-3-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]propanoic acid |
| SMILES | CCCCCCCCC1(NC(=O)NC2CCCCC2C(CC(=O)O)c2[nH]ccc2C(=O)C2OC(C)(C)OCC2(C)C)CCCCC1 |
| InChI | InChI=1S/C37H61N3O6/c1-6-7-8-9-10-14-20-37(21-15-11-16-22-37)40-34(44)39-29-18-13-12-17-26(29)28(24-30(41)42)31-27(19-23-38-31)32(43)33-35(2,3)25-45-36(4,5)46-33/h19,23,26,28-29,33,38H,6-18,20-22,24-25H2,1-5H3,(H,41,42)(H2,39,40,44) |
| InChIKey | IWRKMKGUXXWWIW-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 129.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.91 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|