About 7-chloro-2-cyclopentyl-2,6-diethoxy-3H-inden-1-one
7-chloro-2-cyclopentyl-2,6-diethoxy-3H-inden-1-one (PubChem CID 57295171) has the molecular formula C18H23ClO3
and a molecular weight of 322.83 g/mol. Its IUPAC name is 7-chloro-2-cyclopentyl-2,6-diethoxy-3H-inden-1-one.
Molecular Properties
| Compound Name | 7-chloro-2-cyclopentyl-2,6-diethoxy-3H-inden-1-one |
| PubChem CID | 57295171 |
| Molecular Formula | C18H23ClO3 |
| Molecular Weight | 322.83 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 7-chloro-2-cyclopentyl-2,6-diethoxy-3H-inden-1-one |
| SMILES | CCOc1ccc2c(c1Cl)C(=O)C(OCC)(C1CCCC1)C2 |
| InChI | InChI=1S/C18H23ClO3/c1-3-21-14-10-9-12-11-18(22-4-2,13-7-5-6-8-13)17(20)15(12)16(14)19/h9-10,13H,3-8,11H2,1-2H3 |
| InChIKey | IKXKWQJJRYGXGG-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.83 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-chloro-2-cyclopentyl-2,6-diethoxy-3H-inden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-2-cyclopentyl-2,6-diethoxy-3H-inden-1-one?
The IUPAC name of 7-chloro-2-cyclopentyl-2,6-diethoxy-3H-inden-1-one (CID 57295171) is 7-chloro-2-cyclopentyl-2,6-diethoxy-3H-inden-1-one.
What is the SMILES notation for 7-chloro-2-cyclopentyl-2,6-diethoxy-3H-inden-1-one?
The canonical SMILES for 7-chloro-2-cyclopentyl-2,6-diethoxy-3H-inden-1-one is CCOc1ccc2c(c1Cl)C(=O)C(OCC)(C1CCCC1)C2.
What is the InChIKey of 7-chloro-2-cyclopentyl-2,6-diethoxy-3H-inden-1-one?
The InChIKey is IKXKWQJJRYGXGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23ClO3/c1-3-21-14-10-9-12-11-18(22-4-2,13-7-5-6-8-13)17(20)15(12)16(14)19/h9-10,13H,3-8,11H2,1-2H3.
What are the key properties of 7-chloro-2-cyclopentyl-2,6-diethoxy-3H-inden-1-one?
7-chloro-2-cyclopentyl-2,6-diethoxy-3H-inden-1-one has a molecular weight of 322.83 g/mol, XLogP of 4.44, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-2-cyclopentyl-2,6-diethoxy-3H-inden-1-one is sourced from PubChem (CID 57295171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).