About cyclohexa-1,5-dien-1-ylmethyl carbonochloridate
cyclohexa-1,5-dien-1-ylmethyl carbonochloridate (PubChem CID 57295223) has the molecular formula C8H9ClO2
and a molecular weight of 172.61 g/mol. Its IUPAC name is cyclohexa-1,5-dien-1-ylmethyl carbonochloridate.
Molecular Properties
| Compound Name | cyclohexa-1,5-dien-1-ylmethyl carbonochloridate |
| PubChem CID | 57295223 |
| Molecular Formula | C8H9ClO2 |
| Molecular Weight | 172.61 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | cyclohexa-1,5-dien-1-ylmethyl carbonochloridate |
| SMILES | O=C(Cl)OCC1=CCCC=C1 |
| InChI | InChI=1S/C8H9ClO2/c9-8(10)11-6-7-4-2-1-3-5-7/h2,4-5H,1,3,6H2 |
| InChIKey | CXZSIYDWRPEQLD-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.61 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze cyclohexa-1,5-dien-1-ylmethyl carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-1,5-dien-1-ylmethyl carbonochloridate?
The IUPAC name of cyclohexa-1,5-dien-1-ylmethyl carbonochloridate (CID 57295223) is cyclohexa-1,5-dien-1-ylmethyl carbonochloridate.
What is the SMILES notation for cyclohexa-1,5-dien-1-ylmethyl carbonochloridate?
The canonical SMILES for cyclohexa-1,5-dien-1-ylmethyl carbonochloridate is O=C(Cl)OCC1=CCCC=C1.
What is the InChIKey of cyclohexa-1,5-dien-1-ylmethyl carbonochloridate?
The InChIKey is CXZSIYDWRPEQLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClO2/c9-8(10)11-6-7-4-2-1-3-5-7/h2,4-5H,1,3,6H2.
What are the key properties of cyclohexa-1,5-dien-1-ylmethyl carbonochloridate?
cyclohexa-1,5-dien-1-ylmethyl carbonochloridate has a molecular weight of 172.61 g/mol, XLogP of 2.64, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-1,5-dien-1-ylmethyl carbonochloridate is sourced from PubChem (CID 57295223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).