About 2-[4-[3,4-bis(trifluoromethyl)phenyl]azepan-4-yl]ethanol
2-[4-[3,4-bis(trifluoromethyl)phenyl]azepan-4-yl]ethanol (PubChem CID 57295246) has the molecular formula C16H19F6NO
and a molecular weight of 355.32 g/mol. Its IUPAC name is 2-[4-[3,4-bis(trifluoromethyl)phenyl]azepan-4-yl]ethanol.
Molecular Properties
| Compound Name | 2-[4-[3,4-bis(trifluoromethyl)phenyl]azepan-4-yl]ethanol |
| PubChem CID | 57295246 |
| Molecular Formula | C16H19F6NO |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 2-[4-[3,4-bis(trifluoromethyl)phenyl]azepan-4-yl]ethanol |
| SMILES | OCCC1(c2ccc(C(F)(F)F)c(C(F)(F)F)c2)CCCNCC1 |
| InChI | InChI=1S/C16H19F6NO/c17-15(18,19)12-3-2-11(10-13(12)16(20,21)22)14(6-9-24)4-1-7-23-8-5-14/h2-3,10,23-24H,1,4-9H2 |
| InChIKey | DKBIDDZHPPXHLH-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[4-[3,4-bis(trifluoromethyl)phenyl]azepan-4-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[3,4-bis(trifluoromethyl)phenyl]azepan-4-yl]ethanol?
The IUPAC name of 2-[4-[3,4-bis(trifluoromethyl)phenyl]azepan-4-yl]ethanol (CID 57295246) is 2-[4-[3,4-bis(trifluoromethyl)phenyl]azepan-4-yl]ethanol.
What is the SMILES notation for 2-[4-[3,4-bis(trifluoromethyl)phenyl]azepan-4-yl]ethanol?
The canonical SMILES for 2-[4-[3,4-bis(trifluoromethyl)phenyl]azepan-4-yl]ethanol is OCCC1(c2ccc(C(F)(F)F)c(C(F)(F)F)c2)CCCNCC1.
What is the InChIKey of 2-[4-[3,4-bis(trifluoromethyl)phenyl]azepan-4-yl]ethanol?
The InChIKey is DKBIDDZHPPXHLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19F6NO/c17-15(18,19)12-3-2-11(10-13(12)16(20,21)22)14(6-9-24)4-1-7-23-8-5-14/h2-3,10,23-24H,1,4-9H2.
What are the key properties of 2-[4-[3,4-bis(trifluoromethyl)phenyl]azepan-4-yl]ethanol?
2-[4-[3,4-bis(trifluoromethyl)phenyl]azepan-4-yl]ethanol has a molecular weight of 355.32 g/mol, XLogP of 4.12, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[3,4-bis(trifluoromethyl)phenyl]azepan-4-yl]ethanol is sourced from PubChem (CID 57295246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).