C7H10F3N3O2S2 — CID 57295475
1,1,1-trifluoro-N-[3-(1H-imidazol-2-yl)-3-sulfanylpropyl]methanesulfonamide (PubChem CID 57295475) has the molecular formula C7H10F3N3O2S2 and a molecular weight of 289.30 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[3-(1H-imidazol-2-yl)-3-sulfanylpropyl]methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-[3-(1H-imidazol-2-yl)-3-sulfanylpropyl]methanesulfonamide |
|---|---|
| PubChem CID | 57295475 |
| Molecular Formula | C7H10F3N3O2S2 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | 1,1,1-trifluoro-N-[3-(1H-imidazol-2-yl)-3-sulfanylpropyl]methanesulfonamide |
| SMILES | O=S(=O)(NCCC(S)c1ncc[nH]1)C(F)(F)F |
| InChI | InChI=1S/C7H10F3N3O2S2/c8-7(9,10)17(14,15)13-2-1-5(16)6-11-3-4-12-6/h3-5,13,16H,1-2H2,(H,11,12) |
| InChIKey | PHOSRELGXPVTHG-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|