About 3-(1,5-naphthyridin-4-ylamino)-N,N-dipropylbutanamide
3-(1,5-naphthyridin-4-ylamino)-N,N-dipropylbutanamide (PubChem CID 57295965) has the molecular formula C18H26N4O
and a molecular weight of 314.43 g/mol. Its IUPAC name is 3-(1,5-naphthyridin-4-ylamino)-N,N-dipropylbutanamide.
Molecular Properties
| Compound Name | 3-(1,5-naphthyridin-4-ylamino)-N,N-dipropylbutanamide |
| PubChem CID | 57295965 |
| Molecular Formula | C18H26N4O |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | 3-(1,5-naphthyridin-4-ylamino)-N,N-dipropylbutanamide |
| SMILES | CCCN(CCC)C(=O)CC(C)Nc1ccnc2cccnc12 |
| InChI | InChI=1S/C18H26N4O/c1-4-11-22(12-5-2)17(23)13-14(3)21-16-8-10-19-15-7-6-9-20-18(15)16/h6-10,14H,4-5,11-13H2,1-3H3,(H,19,21) |
| InChIKey | SMYWAGJMCDPHSU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(1,5-naphthyridin-4-ylamino)-N,N-dipropylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,5-naphthyridin-4-ylamino)-N,N-dipropylbutanamide?
The IUPAC name of 3-(1,5-naphthyridin-4-ylamino)-N,N-dipropylbutanamide (CID 57295965) is 3-(1,5-naphthyridin-4-ylamino)-N,N-dipropylbutanamide.
What is the SMILES notation for 3-(1,5-naphthyridin-4-ylamino)-N,N-dipropylbutanamide?
The canonical SMILES for 3-(1,5-naphthyridin-4-ylamino)-N,N-dipropylbutanamide is CCCN(CCC)C(=O)CC(C)Nc1ccnc2cccnc12.
What is the InChIKey of 3-(1,5-naphthyridin-4-ylamino)-N,N-dipropylbutanamide?
The InChIKey is SMYWAGJMCDPHSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N4O/c1-4-11-22(12-5-2)17(23)13-14(3)21-16-8-10-19-15-7-6-9-20-18(15)16/h6-10,14H,4-5,11-13H2,1-3H3,(H,19,21).
What are the key properties of 3-(1,5-naphthyridin-4-ylamino)-N,N-dipropylbutanamide?
3-(1,5-naphthyridin-4-ylamino)-N,N-dipropylbutanamide has a molecular weight of 314.43 g/mol, XLogP of 3.47, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,5-naphthyridin-4-ylamino)-N,N-dipropylbutanamide is sourced from PubChem (CID 57295965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).